C23H15N5O3S — CID 118709951
N-[[3-(6-cyano-1H-benzimidazol-2-yl)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 118709951) has the molecular formula C23H15N5O3S and a molecular weight of 441.47 g/mol. Its IUPAC name is N-[[3-(6-cyano-1H-benzimidazol-2-yl)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[3-(6-cyano-1H-benzimidazol-2-yl)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 118709951 |
| Molecular Formula | C23H15N5O3S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | N-[[3-(6-cyano-1H-benzimidazol-2-yl)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | N#Cc1ccc2nc(-c3cccc(NC(=S)NC(=O)c4ccc5c(c4)OCO5)c3)[nH]c2c1 |
| InChI | InChI=1S/C23H15N5O3S/c24-11-13-4-6-17-18(8-13)27-21(26-17)14-2-1-3-16(9-14)25-23(32)28-22(29)15-5-7-19-20(10-15)31-12-30-19/h1-10H,12H2,(H,26,27)(H2,25,28,29,32) |
| InChIKey | FBDJKGFJMLXBMT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|