C24H20N4O4S — CID 17093002
N-[[5-(1H-benzimidazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 17093002) has the molecular formula C24H20N4O4S and a molecular weight of 460.52 g/mol. Its IUPAC name is N-[[5-(1H-benzimidazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[[5-(1H-benzimidazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 17093002 |
| Molecular Formula | C24H20N4O4S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-[[5-(1H-benzimidazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | COc1ccc(-c2nc3ccccc3[nH]2)cc1NC(=S)NC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H20N4O4S/c1-30-19-8-6-14(22-25-16-4-2-3-5-17(16)26-22)12-18(19)27-24(33)28-23(29)15-7-9-20-21(13-15)32-11-10-31-20/h2-9,12-13H,10-11H2,1H3,(H,25,26)(H2,27,28,29,33) |
| InChIKey | YOPLTNZRBDRKKN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|