C22H16Cl2N4O2S — CID 17092966
N-[[5-(1H-benzimidazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2,4-dichlorobenzamide (PubChem CID 17092966) has the molecular formula C22H16Cl2N4O2S and a molecular weight of 471.37 g/mol. Its IUPAC name is N-[[5-(1H-benzimidazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2,4-dichlorobenzamide.
| Compound Name | N-[[5-(1H-benzimidazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 17092966 |
| Molecular Formula | C22H16Cl2N4O2S |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | N-[[5-(1H-benzimidazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2,4-dichlorobenzamide |
| SMILES | COc1ccc(-c2nc3ccccc3[nH]2)cc1NC(=S)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H16Cl2N4O2S/c1-30-19-9-6-12(20-25-16-4-2-3-5-17(16)26-20)10-18(19)27-22(31)28-21(29)14-8-7-13(23)11-15(14)24/h2-11H,1H3,(H,25,26)(H2,27,28,29,31) |
| InChIKey | RRNLQBCMVMGCQT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|