C21H14ClN5O3S — CID 2977840
N-[[5-(1H-benzimidazol-2-yl)-2-chlorophenyl]carbamothioyl]-2-nitrobenzamide (PubChem CID 2977840) has the molecular formula C21H14ClN5O3S and a molecular weight of 451.90 g/mol. Its IUPAC name is N-[[5-(1H-benzimidazol-2-yl)-2-chlorophenyl]carbamothioyl]-2-nitrobenzamide.
| Compound Name | N-[[5-(1H-benzimidazol-2-yl)-2-chlorophenyl]carbamothioyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 2977840 |
| Molecular Formula | C21H14ClN5O3S |
| Molecular Weight | 451.90 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | N-[[5-(1H-benzimidazol-2-yl)-2-chlorophenyl]carbamothioyl]-2-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1cc(-c2nc3ccccc3[nH]2)ccc1Cl)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H14ClN5O3S/c22-14-10-9-12(19-23-15-6-2-3-7-16(15)24-19)11-17(14)25-21(31)26-20(28)13-5-1-4-8-18(13)27(29)30/h1-11H,(H,23,24)(H2,25,26,28,31) |
| InChIKey | CQCQLHPHDSYHOJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.90 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|