C25H16Cl2N4O2S — CID 17114836
N-[[5-(1H-benzimidazol-2-yl)-2-chlorophenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide (PubChem CID 17114836) has the molecular formula C25H16Cl2N4O2S and a molecular weight of 507.40 g/mol. Its IUPAC name is N-[[5-(1H-benzimidazol-2-yl)-2-chlorophenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[5-(1H-benzimidazol-2-yl)-2-chlorophenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17114836 |
| Molecular Formula | C25H16Cl2N4O2S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | N-[[5-(1H-benzimidazol-2-yl)-2-chlorophenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cc(-c2nc3ccccc3[nH]2)ccc1Cl)c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C25H16Cl2N4O2S/c26-16-5-3-4-14(12-16)21-10-11-22(33-21)24(32)31-25(34)30-20-13-15(8-9-17(20)27)23-28-18-6-1-2-7-19(18)29-23/h1-13H,(H,28,29)(H2,30,31,32,34) |
| InChIKey | NVLKVXJYIJLJIV-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|