C22H19Cl2N3O3S — CID 4512437
N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide (PubChem CID 4512437) has the molecular formula C22H19Cl2N3O3S and a molecular weight of 476.39 g/mol. Its IUPAC name is N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4512437 |
| Molecular Formula | C22H19Cl2N3O3S |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=S)NC(=O)c2ccc(-c3cccc(Cl)c3)o2)c1 |
| InChI | InChI=1S/C22H19Cl2N3O3S/c1-2-4-20(28)25-15-7-8-16(24)17(12-15)26-22(31)27-21(29)19-10-9-18(30-19)13-5-3-6-14(23)11-13/h3,5-12H,2,4H2,1H3,(H,25,28)(H2,26,27,29,31) |
| InChIKey | HEWZXNZIFLAWFY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|