C22H19ClN4O3S2 — CID 4635786
5-(3-chlorophenyl)-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 4635786) has the molecular formula C22H19ClN4O3S2 and a molecular weight of 487.01 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4635786 |
| Molecular Formula | C22H19ClN4O3S2 |
| Molecular Weight | 487.01 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 5-(3-chlorophenyl)-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | CCC(=O)NC(=S)Nc1ccc(NC(=S)NC(=O)c2ccc(-c3cccc(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C22H19ClN4O3S2/c1-2-19(28)26-21(31)24-15-6-8-16(9-7-15)25-22(32)27-20(29)18-11-10-17(30-18)13-4-3-5-14(23)12-13/h3-12H,2H2,1H3,(H2,24,26,28,31)(H2,25,27,29,32) |
| InChIKey | FJNVPMCBFDUKMQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.01 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|