C26H20N4O5S — CID 17115620
5-(3-nitrophenyl)-N-[[4-[(2-phenylacetyl)amino]phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17115620) has the molecular formula C26H20N4O5S and a molecular weight of 500.54 g/mol. Its IUPAC name is 5-(3-nitrophenyl)-N-[[4-[(2-phenylacetyl)amino]phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(3-nitrophenyl)-N-[[4-[(2-phenylacetyl)amino]phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17115620 |
| Molecular Formula | C26H20N4O5S |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 5-(3-nitrophenyl)-N-[[4-[(2-phenylacetyl)amino]phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(NC(=S)NC(=O)c2ccc(-c3cccc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C26H20N4O5S/c31-24(15-17-5-2-1-3-6-17)27-19-9-11-20(12-10-19)28-26(36)29-25(32)23-14-13-22(35-23)18-7-4-8-21(16-18)30(33)34/h1-14,16H,15H2,(H,27,31)(H2,28,29,32,36) |
| InChIKey | MZUUPEVMVWNHJX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|