C22H20Cl2N2O3 — CID 2002810
5-(2,5-dichlorophenyl)-N-[3-(pentanoylamino)phenyl]furan-2-carboxamide (PubChem CID 2002810) has the molecular formula C22H20Cl2N2O3 and a molecular weight of 431.32 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)-N-[3-(pentanoylamino)phenyl]furan-2-carboxamide.
| Compound Name | 5-(2,5-dichlorophenyl)-N-[3-(pentanoylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2002810 |
| Molecular Formula | C22H20Cl2N2O3 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 5-(2,5-dichlorophenyl)-N-[3-(pentanoylamino)phenyl]furan-2-carboxamide |
| SMILES | CCCCC(=O)Nc1cccc(NC(=O)c2ccc(-c3cc(Cl)ccc3Cl)o2)c1 |
| InChI | InChI=1S/C22H20Cl2N2O3/c1-2-3-7-21(27)25-15-5-4-6-16(13-15)26-22(28)20-11-10-19(29-20)17-12-14(23)8-9-18(17)24/h4-6,8-13H,2-3,7H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | HIQXRMYPJQDPOX-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |