C21H13Cl2N5O2S — CID 5141690
5-(2,5-dichlorophenyl)-N-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]furan-2-carboxamide (PubChem CID 5141690) has the molecular formula C21H13Cl2N5O2S and a molecular weight of 470.34 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)-N-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(2,5-dichlorophenyl)-N-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 5141690 |
| Molecular Formula | C21H13Cl2N5O2S |
| Molecular Weight | 470.34 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | 5-(2,5-dichlorophenyl)-N-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]furan-2-carboxamide |
| SMILES | Cc1nnc2sc(-c3cccc(NC(=O)c4ccc(-c5cc(Cl)ccc5Cl)o4)c3)nn12 |
| InChI | InChI=1S/C21H13Cl2N5O2S/c1-11-25-26-21-28(11)27-20(31-21)12-3-2-4-14(9-12)24-19(29)18-8-7-17(30-18)15-10-13(22)5-6-16(15)23/h2-10H,1H3,(H,24,29) |
| InChIKey | XJAIEIMGZUCFGE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.34 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |