C18H13Cl2N5O2S — CID 5014969
2-(2,4-dichlorophenoxy)-N-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]acetamide (PubChem CID 5014969) has the molecular formula C18H13Cl2N5O2S and a molecular weight of 434.31 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 5014969 |
| Molecular Formula | C18H13Cl2N5O2S |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]acetamide |
| SMILES | Cc1nnc2sc(-c3cccc(NC(=O)COc4ccc(Cl)cc4Cl)c3)nn12 |
| InChI | InChI=1S/C18H13Cl2N5O2S/c1-10-22-23-18-25(10)24-17(28-18)11-3-2-4-13(7-11)21-16(26)9-27-15-6-5-12(19)8-14(15)20/h2-8H,9H2,1H3,(H,21,26) |
| InChIKey | UBGCHBIVUBBVPB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |