C19H11Cl2N5OS2 — CID 4257373
3,6-dichloro-N-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 4257373) has the molecular formula C19H11Cl2N5OS2 and a molecular weight of 460.37 g/mol. Its IUPAC name is 3,6-dichloro-N-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4257373 |
| Molecular Formula | C19H11Cl2N5OS2 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | 3,6-dichloro-N-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1nnc2sc(-c3cccc(NC(=O)c4sc5cc(Cl)ccc5c4Cl)c3)nn12 |
| InChI | InChI=1S/C19H11Cl2N5OS2/c1-9-23-24-19-26(9)25-18(29-19)10-3-2-4-12(7-10)22-17(27)16-15(21)13-6-5-11(20)8-14(13)28-16/h2-8H,1H3,(H,22,27) |
| InChIKey | RDPYTCYVLULRSO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |