C20H15ClN6OS2 — CID 17109864
(E)-3-(4-chlorophenyl)-N-[[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 17109864) has the molecular formula C20H15ClN6OS2 and a molecular weight of 454.97 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17109864 |
| Molecular Formula | C20H15ClN6OS2 |
| Molecular Weight | 454.97 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1nnc2sc(-c3cccc(NC(=S)NC(=O)/C=C/c4ccc(Cl)cc4)c3)nn12 |
| InChI | InChI=1S/C20H15ClN6OS2/c1-12-24-25-20-27(12)26-18(30-20)14-3-2-4-16(11-14)22-19(29)23-17(28)10-7-13-5-8-15(21)9-6-13/h2-11H,1H3,(H2,22,23,28,29)/b10-7+ |
| InChIKey | PDXIFGVPELYXDA-JXMROGBWSA-N |
| XLogP | 4.34 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.97 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|