C21H16Cl2N6OS2 — CID 17112294
(E)-3-(2,4-dichlorophenyl)-N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]prop-2-enamide (PubChem CID 17112294) has the molecular formula C21H16Cl2N6OS2 and a molecular weight of 503.44 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17112294 |
| Molecular Formula | C21H16Cl2N6OS2 |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]prop-2-enamide |
| SMILES | Cc1nnc2sc(-c3ccc(CNC(=S)NC(=O)/C=C/c4ccc(Cl)cc4Cl)cc3)nn12 |
| InChI | InChI=1S/C21H16Cl2N6OS2/c1-12-26-27-21-29(12)28-19(32-21)15-4-2-13(3-5-15)11-24-20(31)25-18(30)9-7-14-6-8-16(22)10-17(14)23/h2-10H,11H2,1H3,(H2,24,25,30,31)/b9-7+ |
| InChIKey | XURBNCLIOZTAJA-VQHVLOKHSA-N |
| XLogP | 4.67 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|