C19H15FN6OS2 — CID 22778460
2-fluoro-N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]benzamide (PubChem CID 22778460) has the molecular formula C19H15FN6OS2 and a molecular weight of 426.50 g/mol. Its IUPAC name is 2-fluoro-N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]benzamide.
| Compound Name | 2-fluoro-N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]benzamide |
|---|---|
| PubChem CID | 22778460 |
| Molecular Formula | C19H15FN6OS2 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 2-fluoro-N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]benzamide |
| SMILES | Cc1nnc2sc(-c3ccc(CNC(=S)NC(=O)c4ccccc4F)cc3)nn12 |
| InChI | InChI=1S/C19H15FN6OS2/c1-11-23-24-19-26(11)25-17(29-19)13-8-6-12(7-9-13)10-21-18(28)22-16(27)14-4-2-3-5-15(14)20/h2-9H,10H2,1H3,(H2,21,22,27,28) |
| InChIKey | UOOKTVULHQRYEM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|