C21H14Cl2N6OS3 — CID 17315292
3,6-dichloro-N-[[2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 17315292) has the molecular formula C21H14Cl2N6OS3 and a molecular weight of 533.49 g/mol. Its IUPAC name is 3,6-dichloro-N-[[2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[[2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17315292 |
| Molecular Formula | C21H14Cl2N6OS3 |
| Molecular Weight | 533.49 g/mol |
| Exact Mass | 531.98 |
| IUPAC Name | 3,6-dichloro-N-[[2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(NC(=S)NC(=O)c2sc3cc(Cl)ccc3c2Cl)cccc1-c1nn2c(C)nnc2s1 |
| InChI | InChI=1S/C21H14Cl2N6OS3/c1-9-12(19-28-29-10(2)26-27-21(29)33-19)4-3-5-14(9)24-20(31)25-18(30)17-16(23)13-7-6-11(22)8-15(13)32-17/h3-8H,1-2H3,(H2,24,25,30,31) |
| InChIKey | CRWPJAFQIYXHRP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|