C20H17N7O4S2 — CID 17112175
4-methoxy-N-[[2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-3-nitrobenzamide (PubChem CID 17112175) has the molecular formula C20H17N7O4S2 and a molecular weight of 483.54 g/mol. Its IUPAC name is 4-methoxy-N-[[2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-3-nitrobenzamide.
| Compound Name | 4-methoxy-N-[[2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 17112175 |
| Molecular Formula | C20H17N7O4S2 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 4-methoxy-N-[[2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2cccc(-c3nn4c(C)nnc4s3)c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17N7O4S2/c1-10-13(18-25-26-11(2)23-24-20(26)33-18)5-4-6-14(10)21-19(32)22-17(28)12-7-8-16(31-3)15(9-12)27(29)30/h4-9H,1-3H3,(H2,21,22,28,32) |
| InChIKey | NQHXKEKUHXYANG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|