C18H19N3O6S — CID 5172590
3,4,5-trimethoxy-N-[(2-methyl-3-nitrophenyl)carbamothioyl]benzamide (PubChem CID 5172590) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(2-methyl-3-nitrophenyl)carbamothioyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(2-methyl-3-nitrophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 5172590 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(2-methyl-3-nitrophenyl)carbamothioyl]benzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2cccc([N+](=O)[O-])c2C)cc(OC)c1OC |
| InChI | InChI=1S/C18H19N3O6S/c1-10-12(6-5-7-13(10)21(23)24)19-18(28)20-17(22)11-8-14(25-2)16(27-4)15(9-11)26-3/h5-9H,1-4H3,(H2,19,20,22,28) |
| InChIKey | SGVFEUMSJVJWEQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|