C22H25N3O5S — CID 46761554
N-[[3-(cyclopropanecarbonylamino)-2-methylphenyl]carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 46761554) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is N-[[3-(cyclopropanecarbonylamino)-2-methylphenyl]carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[3-(cyclopropanecarbonylamino)-2-methylphenyl]carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 46761554 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-[[3-(cyclopropanecarbonylamino)-2-methylphenyl]carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2cccc(NC(=O)C3CC3)c2C)cc(OC)c1OC |
| InChI | InChI=1S/C22H25N3O5S/c1-12-15(23-20(26)13-8-9-13)6-5-7-16(12)24-22(31)25-21(27)14-10-17(28-2)19(30-4)18(11-14)29-3/h5-7,10-11,13H,8-9H2,1-4H3,(H,23,26)(H2,24,25,27,31) |
| InChIKey | OHSXCDYWPSCCRW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|