C23H27N3O3S — CID 46761600
2-butoxy-N-[[3-(cyclopropanecarbonylamino)-2-methylphenyl]carbamothioyl]benzamide (PubChem CID 46761600) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-butoxy-N-[[3-(cyclopropanecarbonylamino)-2-methylphenyl]carbamothioyl]benzamide.
| Compound Name | 2-butoxy-N-[[3-(cyclopropanecarbonylamino)-2-methylphenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 46761600 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-butoxy-N-[[3-(cyclopropanecarbonylamino)-2-methylphenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)NC(=S)Nc1cccc(NC(=O)C2CC2)c1C |
| InChI | InChI=1S/C23H27N3O3S/c1-3-4-14-29-20-11-6-5-8-17(20)22(28)26-23(30)25-19-10-7-9-18(15(19)2)24-21(27)16-12-13-16/h5-11,16H,3-4,12-14H2,1-2H3,(H,24,27)(H2,25,26,28,30) |
| InChIKey | PEPDBSBQZRPJBC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|