C25H24N6O5S — CID 130413451
3-(azidomethoxy)-N-[(3-benzamido-2-methylphenyl)carbamothioyl]-4,5-dimethoxybenzamide (PubChem CID 130413451) has the molecular formula C25H24N6O5S and a molecular weight of 520.57 g/mol. Its IUPAC name is 3-(azidomethoxy)-N-[(3-benzamido-2-methylphenyl)carbamothioyl]-4,5-dimethoxybenzamide.
| Compound Name | 3-(azidomethoxy)-N-[(3-benzamido-2-methylphenyl)carbamothioyl]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 130413451 |
| Molecular Formula | C25H24N6O5S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 3-(azidomethoxy)-N-[(3-benzamido-2-methylphenyl)carbamothioyl]-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2cccc(NC(=O)c3ccccc3)c2C)cc(OCN=[N+]=[N-])c1OC |
| InChI | InChI=1S/C25H24N6O5S/c1-15-18(28-23(32)16-8-5-4-6-9-16)10-7-11-19(15)29-25(37)30-24(33)17-12-20(34-2)22(35-3)21(13-17)36-14-27-31-26/h4-13H,14H2,1-3H3,(H,28,32)(H2,29,30,33,37) |
| InChIKey | MQVCJOLHGAGCOE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|