C19H20N2O6S — CID 28688499
3-methyl-4-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]benzoic acid (PubChem CID 28688499) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is 3-methyl-4-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 3-methyl-4-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 28688499 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 3-methyl-4-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]benzoic acid |
| SMILES | COc1cc(C(=O)NC(=S)Nc2ccc(C(=O)O)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N2O6S/c1-10-7-11(18(23)24)5-6-13(10)20-19(28)21-17(22)12-8-14(25-2)16(27-4)15(9-12)26-3/h5-9H,1-4H3,(H,23,24)(H2,20,21,22,28) |
| InChIKey | TYLYISAGBMCGDW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|