C18H16N2O5S — CID 28687679
4-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)-3-methylbenzoic acid (PubChem CID 28687679) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)-3-methylbenzoic acid.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)-3-methylbenzoic acid |
|---|---|
| PubChem CID | 28687679 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1NC(=S)NC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H16N2O5S/c1-10-8-12(17(22)23)2-4-13(10)19-18(26)20-16(21)11-3-5-14-15(9-11)25-7-6-24-14/h2-5,8-9H,6-7H2,1H3,(H,22,23)(H2,19,20,21,26) |
| InChIKey | YWSIWYXNKWIBOL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|