C17H12Cl2N2O5S — CID 28687675
2,4-dichloro-5-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)benzoic acid (PubChem CID 28687675) has the molecular formula C17H12Cl2N2O5S and a molecular weight of 427.27 g/mol. Its IUPAC name is 2,4-dichloro-5-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)benzoic acid.
| Compound Name | 2,4-dichloro-5-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)benzoic acid |
|---|---|
| PubChem CID | 28687675 |
| Molecular Formula | C17H12Cl2N2O5S |
| Molecular Weight | 427.27 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | 2,4-dichloro-5-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)benzoic acid |
| SMILES | O=C(NC(=S)Nc1cc(C(=O)O)c(Cl)cc1Cl)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H12Cl2N2O5S/c18-10-7-11(19)12(6-9(10)16(23)24)20-17(27)21-15(22)8-1-2-13-14(5-8)26-4-3-25-13/h1-2,5-7H,3-4H2,(H,23,24)(H2,20,21,22,27) |
| InChIKey | NGZJJUHGJJBSKJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|