C19H18Cl2N2O3S — CID 28686974
5-[(4-tert-butylbenzoyl)carbamothioylamino]-2,4-dichlorobenzoic acid (PubChem CID 28686974) has the molecular formula C19H18Cl2N2O3S and a molecular weight of 425.34 g/mol. Its IUPAC name is 5-[(4-tert-butylbenzoyl)carbamothioylamino]-2,4-dichlorobenzoic acid.
| Compound Name | 5-[(4-tert-butylbenzoyl)carbamothioylamino]-2,4-dichlorobenzoic acid |
|---|---|
| PubChem CID | 28686974 |
| Molecular Formula | C19H18Cl2N2O3S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 5-[(4-tert-butylbenzoyl)carbamothioylamino]-2,4-dichlorobenzoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=S)Nc2cc(C(=O)O)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O3S/c1-19(2,3)11-6-4-10(5-7-11)16(24)23-18(27)22-15-8-12(17(25)26)13(20)9-14(15)21/h4-9H,1-3H3,(H,25,26)(H2,22,23,24,27) |
| InChIKey | GQAZWNYIBDLVFH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|