C16H11Cl3N2O3S — CID 28687511
2,4-dichloro-5-[(3-chloro-4-methylbenzoyl)carbamothioylamino]benzoic acid (PubChem CID 28687511) has the molecular formula C16H11Cl3N2O3S and a molecular weight of 417.70 g/mol. Its IUPAC name is 2,4-dichloro-5-[(3-chloro-4-methylbenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 2,4-dichloro-5-[(3-chloro-4-methylbenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 28687511 |
| Molecular Formula | C16H11Cl3N2O3S |
| Molecular Weight | 417.70 g/mol |
| Exact Mass | 415.96 |
| IUPAC Name | 2,4-dichloro-5-[(3-chloro-4-methylbenzoyl)carbamothioylamino]benzoic acid |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cc(C(=O)O)c(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl3N2O3S/c1-7-2-3-8(4-10(7)17)14(22)21-16(25)20-13-5-9(15(23)24)11(18)6-12(13)19/h2-6H,1H3,(H,23,24)(H2,20,21,22,25) |
| InChIKey | ILJNPTGSLYZCMP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|