C18H20ClN3OS — CID 53371643
N-[(4-amino-2-chlorophenyl)carbamothioyl]-4-tert-butylbenzamide (PubChem CID 53371643) has the molecular formula C18H20ClN3OS and a molecular weight of 361.90 g/mol. Its IUPAC name is N-[(4-amino-2-chlorophenyl)carbamothioyl]-4-tert-butylbenzamide.
| Compound Name | N-[(4-amino-2-chlorophenyl)carbamothioyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 53371643 |
| Molecular Formula | C18H20ClN3OS |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-[(4-amino-2-chlorophenyl)carbamothioyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=S)Nc2ccc(N)cc2Cl)cc1 |
| InChI | InChI=1S/C18H20ClN3OS/c1-18(2,3)12-6-4-11(5-7-12)16(23)22-17(24)21-15-9-8-13(20)10-14(15)19/h4-10H,20H2,1-3H3,(H2,21,22,23,24) |
| InChIKey | RMKMVHHRHCQJPO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|