C14H9BrCl2N2OS — CID 4673863
4-bromo-N-[(2,4-dichlorophenyl)carbamothioyl]benzamide (PubChem CID 4673863) has the molecular formula C14H9BrCl2N2OS and a molecular weight of 404.12 g/mol. Its IUPAC name is 4-bromo-N-[(2,4-dichlorophenyl)carbamothioyl]benzamide.
| Compound Name | 4-bromo-N-[(2,4-dichlorophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4673863 |
| Molecular Formula | C14H9BrCl2N2OS |
| Molecular Weight | 404.12 g/mol |
| Exact Mass | 401.90 |
| IUPAC Name | 4-bromo-N-[(2,4-dichlorophenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(Cl)cc1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H9BrCl2N2OS/c15-9-3-1-8(2-4-9)13(20)19-14(21)18-12-6-5-10(16)7-11(12)17/h1-7H,(H2,18,19,20,21) |
| InChIKey | QUUYJARSAPEIPR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.12 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|