C17H16Cl2N2O2S — CID 1339065
N-[(2,4-dichlorophenyl)carbamothioyl]-4-propan-2-yloxybenzamide (PubChem CID 1339065) has the molecular formula C17H16Cl2N2O2S and a molecular weight of 383.30 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)carbamothioyl]-4-propan-2-yloxybenzamide.
| Compound Name | N-[(2,4-dichlorophenyl)carbamothioyl]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 1339065 |
| Molecular Formula | C17H16Cl2N2O2S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | N-[(2,4-dichlorophenyl)carbamothioyl]-4-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(C(=O)NC(=S)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H16Cl2N2O2S/c1-10(2)23-13-6-3-11(4-7-13)16(22)21-17(24)20-15-8-5-12(18)9-14(15)19/h3-10H,1-2H3,(H2,20,21,22,24) |
| InChIKey | WTRZHLXIUQRAGJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|