C18H16Cl2N2O4S — CID 50849870
3,5-dichloro-4-[(4-propan-2-yloxybenzoyl)carbamothioylamino]benzoic acid (PubChem CID 50849870) has the molecular formula C18H16Cl2N2O4S and a molecular weight of 427.31 g/mol. Its IUPAC name is 3,5-dichloro-4-[(4-propan-2-yloxybenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 3,5-dichloro-4-[(4-propan-2-yloxybenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 50849870 |
| Molecular Formula | C18H16Cl2N2O4S |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 3,5-dichloro-4-[(4-propan-2-yloxybenzoyl)carbamothioylamino]benzoic acid |
| SMILES | CC(C)Oc1ccc(C(=O)NC(=S)Nc2c(Cl)cc(C(=O)O)cc2Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O4S/c1-9(2)26-12-5-3-10(4-6-12)16(23)22-18(27)21-15-13(19)7-11(17(24)25)8-14(15)20/h3-9H,1-2H3,(H,24,25)(H2,21,22,23,27) |
| InChIKey | UQMVIXPNYSYRDN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|