C17H16Cl3N3O2S — CID 21231494
4-propan-2-yloxy-N-[(2,4,6-trichloroanilino)carbamothioyl]benzamide (PubChem CID 21231494) has the molecular formula C17H16Cl3N3O2S and a molecular weight of 432.76 g/mol. Its IUPAC name is 4-propan-2-yloxy-N-[(2,4,6-trichloroanilino)carbamothioyl]benzamide.
| Compound Name | 4-propan-2-yloxy-N-[(2,4,6-trichloroanilino)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 21231494 |
| Molecular Formula | C17H16Cl3N3O2S |
| Molecular Weight | 432.76 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | 4-propan-2-yloxy-N-[(2,4,6-trichloroanilino)carbamothioyl]benzamide |
| SMILES | CC(C)Oc1ccc(C(=O)NC(=S)NNc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H16Cl3N3O2S/c1-9(2)25-12-5-3-10(4-6-12)16(24)21-17(26)23-22-15-13(19)7-11(18)8-14(15)20/h3-9,22H,1-2H3,(H2,21,23,24,26) |
| InChIKey | FLAWKCYLGYTLMC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.76 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|