C16H14BrClN2O3S — CID 22779129
N-[(4-bromo-2-chlorophenyl)carbamothioyl]-3,5-dimethoxybenzamide (PubChem CID 22779129) has the molecular formula C16H14BrClN2O3S and a molecular weight of 429.72 g/mol. Its IUPAC name is N-[(4-bromo-2-chlorophenyl)carbamothioyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(4-bromo-2-chlorophenyl)carbamothioyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 22779129 |
| Molecular Formula | C16H14BrClN2O3S |
| Molecular Weight | 429.72 g/mol |
| Exact Mass | 427.96 |
| IUPAC Name | N-[(4-bromo-2-chlorophenyl)carbamothioyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(=S)Nc2ccc(Br)cc2Cl)c1 |
| InChI | InChI=1S/C16H14BrClN2O3S/c1-22-11-5-9(6-12(8-11)23-2)15(21)20-16(24)19-14-4-3-10(17)7-13(14)18/h3-8H,1-2H3,(H2,19,20,21,24) |
| InChIKey | LGEKVMPLKCDKAF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.72 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|