C21H16BrClN2O2S — CID 17115492
N-[(4-bromo-2-chlorophenyl)carbamothioyl]-3-phenylmethoxybenzamide (PubChem CID 17115492) has the molecular formula C21H16BrClN2O2S and a molecular weight of 475.80 g/mol. Its IUPAC name is N-[(4-bromo-2-chlorophenyl)carbamothioyl]-3-phenylmethoxybenzamide.
| Compound Name | N-[(4-bromo-2-chlorophenyl)carbamothioyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 17115492 |
| Molecular Formula | C21H16BrClN2O2S |
| Molecular Weight | 475.80 g/mol |
| Exact Mass | 473.98 |
| IUPAC Name | N-[(4-bromo-2-chlorophenyl)carbamothioyl]-3-phenylmethoxybenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(Br)cc1Cl)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H16BrClN2O2S/c22-16-9-10-19(18(23)12-16)24-21(28)25-20(26)15-7-4-8-17(11-15)27-13-14-5-2-1-3-6-14/h1-12H,13H2,(H2,24,25,26,28) |
| InChIKey | VHNBEQCOYXUCDR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.80 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|