C22H18Cl2N2O2S — CID 17134570
N-[(2,4-dichlorophenyl)carbamothioyl]-3-(2-phenylethoxy)benzamide (PubChem CID 17134570) has the molecular formula C22H18Cl2N2O2S and a molecular weight of 445.37 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)carbamothioyl]-3-(2-phenylethoxy)benzamide.
| Compound Name | N-[(2,4-dichlorophenyl)carbamothioyl]-3-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17134570 |
| Molecular Formula | C22H18Cl2N2O2S |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | N-[(2,4-dichlorophenyl)carbamothioyl]-3-(2-phenylethoxy)benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(Cl)cc1Cl)c1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C22H18Cl2N2O2S/c23-17-9-10-20(19(24)14-17)25-22(29)26-21(27)16-7-4-8-18(13-16)28-12-11-15-5-2-1-3-6-15/h1-10,13-14H,11-12H2,(H2,25,26,27,29) |
| InChIKey | YOSMLRITVQFKDW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|