C16H15BrN2O3S — CID 1018544
3-bromo-N-[(2,4-dimethoxyphenyl)carbamothioyl]benzamide (PubChem CID 1018544) has the molecular formula C16H15BrN2O3S and a molecular weight of 395.28 g/mol. Its IUPAC name is 3-bromo-N-[(2,4-dimethoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 3-bromo-N-[(2,4-dimethoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1018544 |
| Molecular Formula | C16H15BrN2O3S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 3-bromo-N-[(2,4-dimethoxyphenyl)carbamothioyl]benzamide |
| SMILES | COc1ccc(NC(=S)NC(=O)c2cccc(Br)c2)c(OC)c1 |
| InChI | InChI=1S/C16H15BrN2O3S/c1-21-12-6-7-13(14(9-12)22-2)18-16(23)19-15(20)10-4-3-5-11(17)8-10/h3-9H,1-2H3,(H2,18,19,20,23) |
| InChIKey | TZEUJADNYDPPHK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|