C15H12BrN3O4S — CID 54791565
3-bromo-N-[(4-methoxy-2-nitrophenyl)carbamothioyl]benzamide (PubChem CID 54791565) has the molecular formula C15H12BrN3O4S and a molecular weight of 410.25 g/mol. Its IUPAC name is 3-bromo-N-[(4-methoxy-2-nitrophenyl)carbamothioyl]benzamide.
| Compound Name | 3-bromo-N-[(4-methoxy-2-nitrophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 54791565 |
| Molecular Formula | C15H12BrN3O4S |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 408.97 |
| IUPAC Name | 3-bromo-N-[(4-methoxy-2-nitrophenyl)carbamothioyl]benzamide |
| SMILES | COc1ccc(NC(=S)NC(=O)c2cccc(Br)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12BrN3O4S/c1-23-11-5-6-12(13(8-11)19(21)22)17-15(24)18-14(20)9-3-2-4-10(16)7-9/h2-8H,1H3,(H2,17,18,20,24) |
| InChIKey | FFANSVSPDQCUQV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|