C17H16BrN3O5S — CID 17353287
5-bromo-2-ethoxy-N-[(4-methoxy-2-nitrophenyl)carbamothioyl]benzamide (PubChem CID 17353287) has the molecular formula C17H16BrN3O5S and a molecular weight of 454.30 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-[(4-methoxy-2-nitrophenyl)carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-ethoxy-N-[(4-methoxy-2-nitrophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17353287 |
| Molecular Formula | C17H16BrN3O5S |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 5-bromo-2-ethoxy-N-[(4-methoxy-2-nitrophenyl)carbamothioyl]benzamide |
| SMILES | CCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16BrN3O5S/c1-3-26-15-7-4-10(18)8-12(15)16(22)20-17(27)19-13-6-5-11(25-2)9-14(13)21(23)24/h4-9H,3H2,1-2H3,(H2,19,20,22,27) |
| InChIKey | BTQJNWBUHMGQGY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|