C20H21N2O3S- — CID 6980514
3-[(4-tert-butylbenzoyl)carbamothioylamino]-4-methylbenzoate (PubChem CID 6980514) has the molecular formula C20H21N2O3S- and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-[(4-tert-butylbenzoyl)carbamothioylamino]-4-methylbenzoate.
| Compound Name | 3-[(4-tert-butylbenzoyl)carbamothioylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 6980514 |
| Molecular Formula | C20H21N2O3S- |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-[(4-tert-butylbenzoyl)carbamothioylamino]-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1NC(=S)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-12-5-6-14(18(24)25)11-16(12)21-19(26)22-17(23)13-7-9-15(10-8-13)20(2,3)4/h5-11H,1-4H3,(H,24,25)(H2,21,22,23,26)/p-1 |
| InChIKey | UCRKYRQVLPYUMP-UHFFFAOYSA-M |
| XLogP | 2.78 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|