C16H12N3O5S- — CID 2294131
4-methyl-3-[(2-nitrobenzoyl)carbamothioylamino]benzoate (PubChem CID 2294131) has the molecular formula C16H12N3O5S- and a molecular weight of 358.36 g/mol. Its IUPAC name is 4-methyl-3-[(2-nitrobenzoyl)carbamothioylamino]benzoate.
| Compound Name | 4-methyl-3-[(2-nitrobenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 2294131 |
| Molecular Formula | C16H12N3O5S- |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 4-methyl-3-[(2-nitrobenzoyl)carbamothioylamino]benzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1NC(=S)NC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13N3O5S/c1-9-6-7-10(15(21)22)8-12(9)17-16(25)18-14(20)11-4-2-3-5-13(11)19(23)24/h2-8H,1H3,(H,21,22)(H2,17,18,20,25)/p-1 |
| InChIKey | OTFZECNRPMJQLC-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 124.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|