C16H12N6O6S2 — CID 11981700
2-nitro-N-[[(2-nitrobenzoyl)carbamothioylamino]carbamothioyl]benzamide (PubChem CID 11981700) has the molecular formula C16H12N6O6S2 and a molecular weight of 448.44 g/mol. Its IUPAC name is 2-nitro-N-[[(2-nitrobenzoyl)carbamothioylamino]carbamothioyl]benzamide.
| Compound Name | 2-nitro-N-[[(2-nitrobenzoyl)carbamothioylamino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 11981700 |
| Molecular Formula | C16H12N6O6S2 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 2-nitro-N-[[(2-nitrobenzoyl)carbamothioylamino]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)NNC(=S)NC(=O)c1ccccc1[N+](=O)[O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12N6O6S2/c23-13(9-5-1-3-7-11(9)21(25)26)17-15(29)19-20-16(30)18-14(24)10-6-2-4-8-12(10)22(27)28/h1-8H,(H2,17,19,23,29)(H2,18,20,24,30) |
| InChIKey | SGNKYPDBOIDOOB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 168.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|