C11H13N3O4S — CID 17161921
N-(2-hydroxypropylcarbamothioyl)-2-nitrobenzamide (PubChem CID 17161921) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is N-(2-hydroxypropylcarbamothioyl)-2-nitrobenzamide.
| Compound Name | N-(2-hydroxypropylcarbamothioyl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 17161921 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-(2-hydroxypropylcarbamothioyl)-2-nitrobenzamide |
| SMILES | CC(O)CNC(=S)NC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O4S/c1-7(15)6-12-11(19)13-10(16)8-4-2-3-5-9(8)14(17)18/h2-5,7,15H,6H2,1H3,(H2,12,13,16,19) |
| InChIKey | OWWVNXRPPBWZNX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|