C11H13FN2O2S — CID 17161957
2-fluoro-N-(2-hydroxypropylcarbamothioyl)benzamide (PubChem CID 17161957) has the molecular formula C11H13FN2O2S and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-fluoro-N-(2-hydroxypropylcarbamothioyl)benzamide.
| Compound Name | 2-fluoro-N-(2-hydroxypropylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 17161957 |
| Molecular Formula | C11H13FN2O2S |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-fluoro-N-(2-hydroxypropylcarbamothioyl)benzamide |
| SMILES | CC(O)CNC(=S)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C11H13FN2O2S/c1-7(15)6-13-11(17)14-10(16)8-4-2-3-5-9(8)12/h2-5,7,15H,6H2,1H3,(H2,13,14,16,17) |
| InChIKey | QXVNHEMNELXJNW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|