C19H15N7O3S2 — CID 17109869
N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-2-nitrobenzamide (PubChem CID 17109869) has the molecular formula C19H15N7O3S2 and a molecular weight of 453.51 g/mol. Its IUPAC name is N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-2-nitrobenzamide.
| Compound Name | N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 17109869 |
| Molecular Formula | C19H15N7O3S2 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-2-nitrobenzamide |
| SMILES | Cc1ccc(-c2nn3c(C)nnc3s2)cc1NC(=S)NC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15N7O3S2/c1-10-7-8-12(17-24-25-11(2)22-23-19(25)31-17)9-14(10)20-18(30)21-16(27)13-5-3-4-6-15(13)26(28)29/h3-9H,1-2H3,(H2,20,21,27,30) |
| InChIKey | QPLAFFNNNNTSDI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|