C21H20N6O3S2 — CID 3919858
3,5-dimethoxy-N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide (PubChem CID 3919858) has the molecular formula C21H20N6O3S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3919858 |
| Molecular Formula | C21H20N6O3S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 3,5-dimethoxy-N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(=S)Nc2cc(-c3nn4c(C)nnc4s3)ccc2C)c1 |
| InChI | InChI=1S/C21H20N6O3S2/c1-11-5-6-13(19-26-27-12(2)24-25-21(27)32-19)9-17(11)22-20(31)23-18(28)14-7-15(29-3)10-16(8-14)30-4/h5-10H,1-4H3,(H2,22,23,28,31) |
| InChIKey | XHEUNBHAXYVLNP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|