C19H14N8OS3 — CID 17336078
N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 17336078) has the molecular formula C19H14N8OS3 and a molecular weight of 466.58 g/mol. Its IUPAC name is N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17336078 |
| Molecular Formula | C19H14N8OS3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | Cc1ccc(-c2nn3c(C)nnc3s2)cc1NC(=S)NC(=O)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C19H14N8OS3/c1-9-3-4-12(17-24-27-10(2)22-23-19(27)30-17)8-14(9)20-18(29)21-16(28)11-5-6-13-15(7-11)26-31-25-13/h3-8H,1-2H3,(H2,20,21,28,29) |
| InChIKey | QBIBZYLLKFBXGK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|