C18H13FN6OS2 — CID 3274065
3-fluoro-N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide (PubChem CID 3274065) has the molecular formula C18H13FN6OS2 and a molecular weight of 412.48 g/mol. Its IUPAC name is 3-fluoro-N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-fluoro-N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3274065 |
| Molecular Formula | C18H13FN6OS2 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 3-fluoro-N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide |
| SMILES | Cc1nnc2sc(-c3ccc(NC(=S)NC(=O)c4cccc(F)c4)cc3)nn12 |
| InChI | InChI=1S/C18H13FN6OS2/c1-10-22-23-18-25(10)24-16(28-18)11-5-7-14(8-6-11)20-17(27)21-15(26)12-3-2-4-13(19)9-12/h2-9H,1H3,(H2,20,21,26,27) |
| InChIKey | UBUSHMLGRAGRQH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|