C15H16N6OS2 — CID 3901180
N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]butanamide (PubChem CID 3901180) has the molecular formula C15H16N6OS2 and a molecular weight of 360.47 g/mol. Its IUPAC name is N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]butanamide.
| Compound Name | N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]butanamide |
|---|---|
| PubChem CID | 3901180 |
| Molecular Formula | C15H16N6OS2 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]butanamide |
| SMILES | CCCC(=O)NC(=S)Nc1ccc(-c2nn3c(C)nnc3s2)cc1 |
| InChI | InChI=1S/C15H16N6OS2/c1-3-4-12(22)17-14(23)16-11-7-5-10(6-8-11)13-20-21-9(2)18-19-15(21)24-13/h5-8H,3-4H2,1-2H3,(H2,16,17,22,23) |
| InChIKey | KPDAXADYKBQGBB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|