C25H28N6O4S2 — CID 3579087
3,4,5-triethoxy-N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide (PubChem CID 3579087) has the molecular formula C25H28N6O4S2 and a molecular weight of 540.67 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3579087 |
| Molecular Formula | C25H28N6O4S2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 3,4,5-triethoxy-N-[[2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2cc(-c3nn4c(C)nnc4s3)ccc2C)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H28N6O4S2/c1-6-33-19-12-17(13-20(34-7-2)21(19)35-8-3)22(32)27-24(36)26-18-11-16(10-9-14(18)4)23-30-31-15(5)28-29-25(31)37-23/h9-13H,6-8H2,1-5H3,(H2,26,27,32,36) |
| InChIKey | QEIXTIINCXMFCD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|