C22H22N6OS2 — CID 3738895
4-ethyl-N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]benzamide (PubChem CID 3738895) has the molecular formula C22H22N6OS2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 4-ethyl-N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]benzamide.
| Compound Name | 4-ethyl-N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3738895 |
| Molecular Formula | C22H22N6OS2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 4-ethyl-N-[[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methylphenyl]carbamothioyl]benzamide |
| SMILES | CCc1ccc(C(=O)NC(=S)Nc2cc(-c3nn4c(CC)nnc4s3)ccc2C)cc1 |
| InChI | InChI=1S/C22H22N6OS2/c1-4-14-7-10-15(11-8-14)19(29)24-21(30)23-17-12-16(9-6-13(17)3)20-27-28-18(5-2)25-26-22(28)31-20/h6-12H,4-5H2,1-3H3,(H2,23,24,29,30) |
| InChIKey | ARHRGNYLMHRDMX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|