C21H20N6OS2 — CID 17334183
N-[[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-3,4-dimethylbenzamide (PubChem CID 17334183) has the molecular formula C21H20N6OS2 and a molecular weight of 436.57 g/mol. Its IUPAC name is N-[[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-3,4-dimethylbenzamide.
| Compound Name | N-[[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 17334183 |
| Molecular Formula | C21H20N6OS2 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | N-[[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-3,4-dimethylbenzamide |
| SMILES | CCc1nnc2sc(-c3cccc(NC(=S)NC(=O)c4ccc(C)c(C)c4)c3)nn12 |
| InChI | InChI=1S/C21H20N6OS2/c1-4-17-24-25-21-27(17)26-19(30-21)15-6-5-7-16(11-15)22-20(29)23-18(28)14-9-8-12(2)13(3)10-14/h5-11H,4H2,1-3H3,(H2,22,23,28,29) |
| InChIKey | ABBXFOHDNGDUCA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|